![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| US Geological Survey 7th Ed | 22-Aug-2005 18:24 | 8.7K | |
| Tectonophysics | 22-Aug-2005 18:24 | 6.9K | |
| Tectonics | 22-Aug-2005 18:24 | 5.1K | |
| Sedimentology | 22-Aug-2005 18:24 | 5.2K | |
| Sedimentary Geology | 22-Aug-2005 18:24 | 6.9K | |
| Reviews of Geophysics | 22-Aug-2005 18:24 | 3.7K | |
| Review of Palaeo & Palyn | 22-Aug-2005 18:24 | 6.9K | |
| Quaternary Research | 22-Aug-2005 18:24 | 4.9K | |
| Precambrian Research | 22-Aug-2005 18:24 | 6.9K | |
| Physics of Earth & Planetary In | 22-Aug-2005 18:24 | 6.9K | |
| Palaeogeography | 22-Aug-2005 18:24 | 6.9K | |
| Organic Geochmistry | 22-Aug-2005 18:24 | 4.6K | |
| Ore Geology Reviews | 22-Aug-2005 18:24 | 6.9K | |
| Meteoritics | 22-Aug-2005 18:24 | 4.8K | |
| Marine Micropaleontology | 22-Aug-2005 18:24 | 6.9K | |
| Marine Geology | 22-Aug-2005 18:24 | 6.9K | |
| Marine Chemistry | 22-Aug-2005 18:24 | 6.9K | |
| Lithos | 22-Aug-2005 18:24 | 6.9K | |
| J of Volc Geothermal Res | 22-Aug-2005 18:24 | 6.9K | |
| J of Structural Geology | 22-Aug-2005 18:24 | 4.9K | |
| J of Sedimentary Research | 22-Aug-2005 18:24 | 6.4K | |
| J of Petroleum Sci & Engn | 22-Aug-2005 18:24 | 6.9K | |
| J of Petroleum Geology | 22-Aug-2005 18:24 | 4.8K | |
| J of Metamorphic Geology | 22-Aug-2005 18:24 | 4.9K | |
| J of Marine Systems | 22-Aug-2005 18:24 | 6.9K | |
| J of Hydrology | 22-Aug-2005 18:24 | 6.9K | |
| J of Geophysical Research | 22-Aug-2005 18:24 | 4.7K | |
| J of Geology | 22-Aug-2005 18:24 | 6.2K | |
| J of Geochem Exploration | 22-Aug-2005 18:24 | 6.9K | |
| J of Contaminant Hydrology | 22-Aug-2005 18:24 | 6.9K | |
| J of Appl Geophysics | 22-Aug-2005 18:24 | 6.9K | |
| Intl J of Mineral Processing | 22-Aug-2005 18:24 | 6.9K | |
| Intl J of Coal Geology | 22-Aug-2005 18:24 | 6.9K | |
| ISPRS J Photo Remote Sensing | 22-Aug-2005 18:24 | 6.9K | |
| Hydrometallurgy | 22-Aug-2005 18:24 | 6.9K | |
| Global & Planetary Change | 22-Aug-2005 18:24 | 6.9K | |
| Geostandards Newsletter | 22-Aug-2005 18:24 | 4.9K | |
| Geomorphology | 22-Aug-2005 18:24 | 6.9K | |
| Geology | 22-Aug-2005 18:24 | 5.1K | |
| Geoderma | 22-Aug-2005 18:24 | 6.9K | |
| Geochimica et Cosmochimica Acta | 22-Aug-2005 18:24 | 5.0K | |
| GSA Bulletin | 22-Aug-2005 18:24 | 7.0K | |
| Engineering Geology | 22-Aug-2005 18:24 | 6.9K | |
| Economic Geology | 22-Aug-2005 18:24 | 6.1K | |
| Earth Planetary Science Let | 22-Aug-2005 18:24 | 5.1K | |
| Earth-Science Reviews | 22-Aug-2005 18:24 | 6.9K | |
| Dynamics of Atmo & Oceans | 22-Aug-2005 18:24 | 6.9K | |
| Cold Regions Science & Tech | 22-Aug-2005 18:24 | 6.9K | |
| Coastal Engineering | 22-Aug-2005 18:24 | 6.9K | |
| Chemical Geology | 22-Aug-2005 18:24 | 6.9K | |
| Catena | 22-Aug-2005 18:24 | 6.9K | |
| Atmospheric Research | 22-Aug-2005 18:24 | 6.9K | |
| Applied Clay Catalysis | 22-Aug-2005 18:24 | 6.9K | |
| Amer Mineralogist | 22-Aug-2005 18:24 | 4.3K | |
| Amer J of Science | 22-Aug-2005 18:24 | 4.5K | |
| Agri & Forest Meteorology | 22-Aug-2005 18:24 | 6.9K | |
| AAPG Bulletin | 22-Aug-2005 18:24 | 6.3K | |